C25H25N5O3 — CID 111553419
N-(furan-2-ylmethyl)-3-[[[N'-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]methyl]benzamide (PubChem CID 111553419) has the molecular formula C25H25N5O3 and a molecular weight of 443.51 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-[[[N'-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]methyl]benzamide.
| Compound Name | N-(furan-2-ylmethyl)-3-[[[N'-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111553419 |
| Molecular Formula | C25H25N5O3 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-[[[N'-methyl-N-[(2-phenyl-1,3-oxazol-4-yl)methyl]carbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(/NCc1cccc(C(=O)NCc2ccco2)c1)NCc1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H25N5O3/c1-26-25(29-15-21-17-33-24(30-21)19-8-3-2-4-9-19)28-14-18-7-5-10-20(13-18)23(31)27-16-22-11-6-12-32-22/h2-13,17H,14-16H2,1H3,(H,27,31)(H2,26,28,29) |
| InChIKey | TXOCRMRBIDLJFT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|