C25H29N5O3 — CID 111872893
3-[[[N-[[4-(dimethylcarbamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]-N-(furan-2-ylmethyl)benzamide (PubChem CID 111872893) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is 3-[[[N-[[4-(dimethylcarbamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 3-[[[N-[[4-(dimethylcarbamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 111872893 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 3-[[[N-[[4-(dimethylcarbamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]-N-(furan-2-ylmethyl)benzamide |
| SMILES | C/N=C(\NCc1ccc(C(=O)N(C)C)cc1)NCc1cccc(C(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C25H29N5O3/c1-26-25(28-15-18-9-11-20(12-10-18)24(32)30(2)3)29-16-19-6-4-7-21(14-19)23(31)27-17-22-8-5-13-33-22/h4-14H,15-17H2,1-3H3,(H,27,31)(H2,26,28,29) |
| InChIKey | QSUIXSYQOWNHPI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|