C23H26N4O2 — CID 110950668
3-[[(N-benzyl-N,N'-dimethylcarbamimidoyl)amino]methyl]-N-(furan-2-ylmethyl)benzamide (PubChem CID 110950668) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 3-[[(N-benzyl-N,N'-dimethylcarbamimidoyl)amino]methyl]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 3-[[(N-benzyl-N,N'-dimethylcarbamimidoyl)amino]methyl]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 110950668 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 3-[[(N-benzyl-N,N'-dimethylcarbamimidoyl)amino]methyl]-N-(furan-2-ylmethyl)benzamide |
| SMILES | C/N=C(/NCc1cccc(C(=O)NCc2ccco2)c1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C23H26N4O2/c1-24-23(27(2)17-18-8-4-3-5-9-18)26-15-19-10-6-11-20(14-19)22(28)25-16-21-12-7-13-29-21/h3-14H,15-17H2,1-2H3,(H,24,26)(H,25,28) |
| InChIKey | GDOLMPKQCOLWKT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|