C20H26N4O — CID 110950852
3-[[(N-benzyl-N,N'-dimethylcarbamimidoyl)amino]methyl]-N-ethylbenzamide (PubChem CID 110950852) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is 3-[[(N-benzyl-N,N'-dimethylcarbamimidoyl)amino]methyl]-N-ethylbenzamide.
| Compound Name | 3-[[(N-benzyl-N,N'-dimethylcarbamimidoyl)amino]methyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 110950852 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 3-[[(N-benzyl-N,N'-dimethylcarbamimidoyl)amino]methyl]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cccc(CN/C(=N/C)N(C)Cc2ccccc2)c1 |
| InChI | InChI=1S/C20H26N4O/c1-4-22-19(25)18-12-8-11-17(13-18)14-23-20(21-2)24(3)15-16-9-6-5-7-10-16/h5-13H,4,14-15H2,1-3H3,(H,21,23)(H,22,25) |
| InChIKey | HHUHHZWVDYQIBA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|