C21H28N4OS — CID 111298841
3-[[[N,N'-dimethyl-N-[(4-methylsulfanylphenyl)methyl]carbamimidoyl]amino]methyl]-N-ethylbenzamide (PubChem CID 111298841) has the molecular formula C21H28N4OS and a molecular weight of 384.55 g/mol. Its IUPAC name is 3-[[[N,N'-dimethyl-N-[(4-methylsulfanylphenyl)methyl]carbamimidoyl]amino]methyl]-N-ethylbenzamide.
| Compound Name | 3-[[[N,N'-dimethyl-N-[(4-methylsulfanylphenyl)methyl]carbamimidoyl]amino]methyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 111298841 |
| Molecular Formula | C21H28N4OS |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 3-[[[N,N'-dimethyl-N-[(4-methylsulfanylphenyl)methyl]carbamimidoyl]amino]methyl]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cccc(CN/C(=N/C)N(C)Cc2ccc(SC)cc2)c1 |
| InChI | InChI=1S/C21H28N4OS/c1-5-23-20(26)18-8-6-7-17(13-18)14-24-21(22-2)25(3)15-16-9-11-19(27-4)12-10-16/h6-13H,5,14-15H2,1-4H3,(H,22,24)(H,23,26) |
| InChIKey | BDKGCGXRYNWQCQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|