C21H29IN4OS — CID 111298816
4-[[[N,N'-dimethyl-N-[(4-methylsulfanylphenyl)methyl]carbamimidoyl]amino]methyl]-N-ethylbenzamide;hydroiodide (PubChem CID 111298816) has the molecular formula C21H29IN4OS and a molecular weight of 512.46 g/mol. Its IUPAC name is 4-[[[N,N'-dimethyl-N-[(4-methylsulfanylphenyl)methyl]carbamimidoyl]amino]methyl]-N-ethylbenzamide;hydroiodide.
| Compound Name | 4-[[[N,N'-dimethyl-N-[(4-methylsulfanylphenyl)methyl]carbamimidoyl]amino]methyl]-N-ethylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111298816 |
| Molecular Formula | C21H29IN4OS |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | 4-[[[N,N'-dimethyl-N-[(4-methylsulfanylphenyl)methyl]carbamimidoyl]amino]methyl]-N-ethylbenzamide;hydroiodide |
| SMILES | CCNC(=O)c1ccc(CN/C(=N/C)N(C)Cc2ccc(SC)cc2)cc1.I |
| InChI | InChI=1S/C21H28N4OS.HI/c1-5-23-20(26)18-10-6-16(7-11-18)14-24-21(22-2)25(3)15-17-8-12-19(27-4)13-9-17;/h6-13H,5,14-15H2,1-4H3,(H,22,24)(H,23,26);1H |
| InChIKey | LHPLHLUEPQQXST-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|