C20H20IN5O — CID 111553146
1-[(3-cyanophenyl)methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111553146) has the molecular formula C20H20IN5O and a molecular weight of 473.32 g/mol. Its IUPAC name is 1-[(3-cyanophenyl)methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(3-cyanophenyl)methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111553146 |
| Molecular Formula | C20H20IN5O |
| Molecular Weight | 473.32 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | 1-[(3-cyanophenyl)methyl]-2-methyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(C#N)c1)NCc1coc(-c2ccccc2)n1.I |
| InChI | InChI=1S/C20H19N5O.HI/c1-22-20(23-12-16-7-5-6-15(10-16)11-21)24-13-18-14-26-19(25-18)17-8-3-2-4-9-17;/h2-10,14H,12-13H2,1H3,(H2,22,23,24);1H |
| InChIKey | VJYNKJXRCLDACU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 86.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|