C24H29IN4O2S — CID 111677265
N-(furan-2-ylmethyl)-3-[[[N'-methyl-N-(2-phenylsulfanylpropyl)carbamimidoyl]amino]methyl]benzamide;hydroiodide (PubChem CID 111677265) has the molecular formula C24H29IN4O2S and a molecular weight of 564.49 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-[[[N'-methyl-N-(2-phenylsulfanylpropyl)carbamimidoyl]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-(furan-2-ylmethyl)-3-[[[N'-methyl-N-(2-phenylsulfanylpropyl)carbamimidoyl]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111677265 |
| Molecular Formula | C24H29IN4O2S |
| Molecular Weight | 564.49 g/mol |
| Exact Mass | 564.11 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-[[[N'-methyl-N-(2-phenylsulfanylpropyl)carbamimidoyl]amino]methyl]benzamide;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(C(=O)NCc2ccco2)c1)NCC(C)Sc1ccccc1.I |
| InChI | InChI=1S/C24H28N4O2S.HI/c1-18(31-22-11-4-3-5-12-22)15-27-24(25-2)28-16-19-8-6-9-20(14-19)23(29)26-17-21-10-7-13-30-21;/h3-14,18H,15-17H2,1-2H3,(H,26,29)(H2,25,27,28);1H |
| InChIKey | WGMAARYJGLELQK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|