C25H31N5O2 — CID 111590273
3-[[[ethylamino-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methylamino]methylidene]amino]methyl]-N-propylbenzamide (PubChem CID 111590273) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 3-[[[ethylamino-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methylamino]methylidene]amino]methyl]-N-propylbenzamide.
| Compound Name | 3-[[[ethylamino-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methylamino]methylidene]amino]methyl]-N-propylbenzamide |
|---|---|
| PubChem CID | 111590273 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 3-[[[ethylamino-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methylamino]methylidene]amino]methyl]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1cccc(C/N=C(\NCC)NCc2coc(-c3ccc(C)cc3)n2)c1 |
| InChI | InChI=1S/C25H31N5O2/c1-4-13-27-23(31)21-8-6-7-19(14-21)15-28-25(26-5-2)29-16-22-17-32-24(30-22)20-11-9-18(3)10-12-20/h6-12,14,17H,4-5,13,15-16H2,1-3H3,(H,27,31)(H2,26,28,29) |
| InChIKey | DOPDEUIXTNTHTF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|