C22H27N5O3S — CID 111591437
1-ethyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-2-[[3-(methylsulfamoyl)phenyl]methyl]guanidine (PubChem CID 111591437) has the molecular formula C22H27N5O3S and a molecular weight of 441.56 g/mol. Its IUPAC name is 1-ethyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-2-[[3-(methylsulfamoyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-2-[[3-(methylsulfamoyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111591437 |
| Molecular Formula | C22H27N5O3S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 1-ethyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-2-[[3-(methylsulfamoyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(S(=O)(=O)NC)c1)NCc1coc(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C22H27N5O3S/c1-4-24-22(25-13-17-6-5-7-20(12-17)31(28,29)23-3)26-14-19-15-30-21(27-19)18-10-8-16(2)9-11-18/h5-12,15,23H,4,13-14H2,1-3H3,(H2,24,25,26) |
| InChIKey | PSNMUXKQGDJCDH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|