C24H28IN7O — CID 111591396
1-ethyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111591396) has the molecular formula C24H28IN7O and a molecular weight of 557.44 g/mol. Its IUPAC name is 1-ethyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111591396 |
| Molecular Formula | C24H28IN7O |
| Molecular Weight | 557.44 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | 1-ethyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-2-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(Cn2cncn2)c1)NCc1coc(-c2ccc(C)cc2)n1.I |
| InChI | InChI=1S/C24H27N7O.HI/c1-3-26-24(27-12-19-5-4-6-20(11-19)14-31-17-25-16-29-31)28-13-22-15-32-23(30-22)21-9-7-18(2)8-10-21;/h4-11,15-17H,3,12-14H2,1-2H3,(H2,26,27,28);1H |
| InChIKey | VEKPONJVCIIYML-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 93.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|