C22H24IN7O — CID 111553550
1-ethyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111553550) has the molecular formula C22H24IN7O and a molecular weight of 529.39 g/mol. Its IUPAC name is 1-ethyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111553550 |
| Molecular Formula | C22H24IN7O |
| Molecular Weight | 529.39 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | 1-ethyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(-n2cncn2)cc1)NCc1coc(-c2ccccc2)n1.I |
| InChI | InChI=1S/C22H23N7O.HI/c1-2-24-22(25-12-17-8-10-20(11-9-17)29-16-23-15-27-29)26-13-19-14-30-21(28-19)18-6-4-3-5-7-18;/h3-11,14-16H,2,12-13H2,1H3,(H2,24,25,26);1H |
| InChIKey | LKIUVTPARKRJEX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 93.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|