C19H20BrFN2O2 — CID 47043729
2-bromo-N-[[3-(butan-2-ylcarbamoyl)phenyl]methyl]-4-fluorobenzamide (PubChem CID 47043729) has the molecular formula C19H20BrFN2O2 and a molecular weight of 407.28 g/mol. Its IUPAC name is 2-bromo-N-[[3-(butan-2-ylcarbamoyl)phenyl]methyl]-4-fluorobenzamide.
| Compound Name | 2-bromo-N-[[3-(butan-2-ylcarbamoyl)phenyl]methyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 47043729 |
| Molecular Formula | C19H20BrFN2O2 |
| Molecular Weight | 407.28 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 2-bromo-N-[[3-(butan-2-ylcarbamoyl)phenyl]methyl]-4-fluorobenzamide |
| SMILES | CCC(C)NC(=O)c1cccc(CNC(=O)c2ccc(F)cc2Br)c1 |
| InChI | InChI=1S/C19H20BrFN2O2/c1-3-12(2)23-18(24)14-6-4-5-13(9-14)11-22-19(25)16-8-7-15(21)10-17(16)20/h4-10,12H,3,11H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | MLBIANXNLSJTTR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.28 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |