C24H26FN5O4 — CID 143710044
(2S)-2-[[1-[(6-fluoronaphthalen-2-yl)methyl]-2-oxopyridine-3-carbonyl]amino]-5-[(N'-methylcarbamimidoyl)amino]pentanoic acid (PubChem CID 143710044) has the molecular formula C24H26FN5O4 and a molecular weight of 467.50 g/mol. Its IUPAC name is (2S)-2-[[1-[(6-fluoronaphthalen-2-yl)methyl]-2-oxopyridine-3-carbonyl]amino]-5-[(N'-methylcarbamimidoyl)amino]pentanoic acid.
| Compound Name | (2S)-2-[[1-[(6-fluoronaphthalen-2-yl)methyl]-2-oxopyridine-3-carbonyl]amino]-5-[(N'-methylcarbamimidoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 143710044 |
| Molecular Formula | C24H26FN5O4 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | (2S)-2-[[1-[(6-fluoronaphthalen-2-yl)methyl]-2-oxopyridine-3-carbonyl]amino]-5-[(N'-methylcarbamimidoyl)amino]pentanoic acid |
| SMILES | C/N=C(\N)NCCC[C@H](NC(=O)c1cccn(Cc2ccc3cc(F)ccc3c2)c1=O)C(=O)O |
| InChI | InChI=1S/C24H26FN5O4/c1-27-24(26)28-10-2-5-20(23(33)34)29-21(31)19-4-3-11-30(22(19)32)14-15-6-7-17-13-18(25)9-8-16(17)12-15/h3-4,6-9,11-13,20H,2,5,10,14H2,1H3,(H,29,31)(H,33,34)(H3,26,27,28)/t20-/m0/s1 |
| InChIKey | MIWMIJPXCXEYSK-FQEVSTJZSA-N |
| XLogP | 1.69 |
| TPSA | 138.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|