C23H24F6N4O6 — CID 86622171
(2S)-5-(1-aminoethylideneamino)-2-[[2-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]pyridine-3-carbonyl]amino]pentanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 86622171) has the molecular formula C23H24F6N4O6 and a molecular weight of 566.46 g/mol. Its IUPAC name is (2S)-5-(1-aminoethylideneamino)-2-[[2-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]pyridine-3-carbonyl]amino]pentanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-5-(1-aminoethylideneamino)-2-[[2-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]pyridine-3-carbonyl]amino]pentanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86622171 |
| Molecular Formula | C23H24F6N4O6 |
| Molecular Weight | 566.46 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | (2S)-5-(1-aminoethylideneamino)-2-[[2-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]pyridine-3-carbonyl]amino]pentanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | C/C(N)=N\CCC[C@H](NC(=O)c1cccn(Cc2ccc(C(F)(F)F)cc2)c1=O)C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H23F3N4O4.C2HF3O2/c1-13(25)26-10-2-5-17(20(31)32)27-18(29)16-4-3-11-28(19(16)30)12-14-6-8-15(9-7-14)21(22,23)24;3-2(4,5)1(6)7/h3-4,6-9,11,17H,2,5,10,12H2,1H3,(H2,25,26)(H,27,29)(H,31,32);(H,6,7)/t17-;/m0./s1 |
| InChIKey | OSIPUZQKLZRVJJ-LMOVPXPDSA-N |
| XLogP | 2.89 |
| TPSA | 164.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|