C25H27N5O4 — CID 25158029
(2S)-2-[(1-benzhydryl-2-oxopyridine-3-carbonyl)amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 25158029) has the molecular formula C25H27N5O4 and a molecular weight of 461.52 g/mol. Its IUPAC name is (2S)-2-[(1-benzhydryl-2-oxopyridine-3-carbonyl)amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[(1-benzhydryl-2-oxopyridine-3-carbonyl)amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 25158029 |
| Molecular Formula | C25H27N5O4 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | (2S)-2-[(1-benzhydryl-2-oxopyridine-3-carbonyl)amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)c1cccn(C(c2ccccc2)c2ccccc2)c1=O)C(=O)O |
| InChI | InChI=1S/C25H27N5O4/c26-25(27)28-15-7-14-20(24(33)34)29-22(31)19-13-8-16-30(23(19)32)21(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-6,8-13,16,20-21H,7,14-15H2,(H,29,31)(H,33,34)(H4,26,27,28)/t20-/m0/s1 |
| InChIKey | KCLMFTSYOSHYAX-FQEVSTJZSA-N |
| XLogP | 1.72 |
| TPSA | 152.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|