C28H35N5O4 — CID 143710147
1-[bis(3-methylphenyl)methyl]-3-methylpyridin-2-one;5-(diaminomethylideneamino)-2-formamidopentanoic acid (PubChem CID 143710147) has the molecular formula C28H35N5O4 and a molecular weight of 505.62 g/mol. Its IUPAC name is 1-[bis(3-methylphenyl)methyl]-3-methylpyridin-2-one;5-(diaminomethylideneamino)-2-formamidopentanoic acid.
| Compound Name | 1-[bis(3-methylphenyl)methyl]-3-methylpyridin-2-one;5-(diaminomethylideneamino)-2-formamidopentanoic acid |
|---|---|
| PubChem CID | 143710147 |
| Molecular Formula | C28H35N5O4 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | 1-[bis(3-methylphenyl)methyl]-3-methylpyridin-2-one;5-(diaminomethylideneamino)-2-formamidopentanoic acid |
| SMILES | Cc1cccc(C(c2cccc(C)c2)n2cccc(C)c2=O)c1.NC(N)=NCCCC(NC=O)C(=O)O |
| InChI | InChI=1S/C21H21NO.C7H14N4O3/c1-15-7-4-10-18(13-15)20(19-11-5-8-16(2)14-19)22-12-6-9-17(3)21(22)23;8-7(9)10-3-1-2-5(6(13)14)11-4-12/h4-14,20H,1-3H3;4-5H,1-3H2,(H,11,12)(H,13,14)(H4,8,9,10) |
| InChIKey | HRGXROFNIQRBKM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 152.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|