C30H38N4O4 — CID 143710066
1-benzhydryl-3-methylpyridin-2-one;ethyl 6-(1-aminoethylideneamino)-2-formamidohexanoate (PubChem CID 143710066) has the molecular formula C30H38N4O4 and a molecular weight of 518.66 g/mol. Its IUPAC name is 1-benzhydryl-3-methylpyridin-2-one;ethyl 6-(1-aminoethylideneamino)-2-formamidohexanoate.
| Compound Name | 1-benzhydryl-3-methylpyridin-2-one;ethyl 6-(1-aminoethylideneamino)-2-formamidohexanoate |
|---|---|
| PubChem CID | 143710066 |
| Molecular Formula | C30H38N4O4 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 1-benzhydryl-3-methylpyridin-2-one;ethyl 6-(1-aminoethylideneamino)-2-formamidohexanoate |
| SMILES | CCOC(=O)C(CCCC/N=C(\C)N)NC=O.Cc1cccn(C(c2ccccc2)c2ccccc2)c1=O |
| InChI | InChI=1S/C19H17NO.C11H21N3O3/c1-15-9-8-14-20(19(15)21)18(16-10-4-2-5-11-16)17-12-6-3-7-13-17;1-3-17-11(16)10(14-8-15)6-4-5-7-13-9(2)12/h2-14,18H,1H3;8,10H,3-7H2,1-2H3,(H2,12,13)(H,14,15) |
| InChIKey | GMISPMLUKRTACZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 115.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|