C35H45N5O6 — CID 86622143
tert-butyl (2S)-2-[(1-benzhydryl-2-oxopyridine-3-carbonyl)amino]-5-[[(ethoxycarbonylamino)-(propan-2-ylamino)methylidene]amino]pentanoate (PubChem CID 86622143) has the molecular formula C35H45N5O6 and a molecular weight of 631.77 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(1-benzhydryl-2-oxopyridine-3-carbonyl)amino]-5-[[(ethoxycarbonylamino)-(propan-2-ylamino)methylidene]amino]pentanoate.
| Compound Name | tert-butyl (2S)-2-[(1-benzhydryl-2-oxopyridine-3-carbonyl)amino]-5-[[(ethoxycarbonylamino)-(propan-2-ylamino)methylidene]amino]pentanoate |
|---|---|
| PubChem CID | 86622143 |
| Molecular Formula | C35H45N5O6 |
| Molecular Weight | 631.77 g/mol |
| Exact Mass | 631.34 |
| IUPAC Name | tert-butyl (2S)-2-[(1-benzhydryl-2-oxopyridine-3-carbonyl)amino]-5-[[(ethoxycarbonylamino)-(propan-2-ylamino)methylidene]amino]pentanoate |
| SMILES | CCOC(=O)N/C(=N/CCC[C@H](NC(=O)c1cccn(C(c2ccccc2)c2ccccc2)c1=O)C(=O)OC(C)(C)C)NC(C)C |
| InChI | InChI=1S/C35H45N5O6/c1-7-45-34(44)39-33(37-24(2)3)36-22-14-21-28(32(43)46-35(4,5)6)38-30(41)27-20-15-23-40(31(27)42)29(25-16-10-8-11-17-25)26-18-12-9-13-19-26/h8-13,15-20,23-24,28-29H,7,14,21-22H2,1-6H3,(H,38,41)(H2,36,37,39,44)/t28-/m0/s1 |
| InChIKey | WCMZJMSVVDMYFU-NDEPHWFRSA-N |
| XLogP | 4.81 |
| TPSA | 140.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.77 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|