C30H36N4O4 — CID 59775001
tert-butyl (2S)-5-(1-aminoethylideneamino)-2-[(1-benzyl-2-oxo-6-phenylpyridine-3-carbonyl)amino]pentanoate (PubChem CID 59775001) has the molecular formula C30H36N4O4 and a molecular weight of 516.64 g/mol. Its IUPAC name is tert-butyl (2S)-5-(1-aminoethylideneamino)-2-[(1-benzyl-2-oxo-6-phenylpyridine-3-carbonyl)amino]pentanoate.
| Compound Name | tert-butyl (2S)-5-(1-aminoethylideneamino)-2-[(1-benzyl-2-oxo-6-phenylpyridine-3-carbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 59775001 |
| Molecular Formula | C30H36N4O4 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | tert-butyl (2S)-5-(1-aminoethylideneamino)-2-[(1-benzyl-2-oxo-6-phenylpyridine-3-carbonyl)amino]pentanoate |
| SMILES | C/C(N)=N\CCC[C@H](NC(=O)c1ccc(-c2ccccc2)n(Cc2ccccc2)c1=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H36N4O4/c1-21(31)32-19-11-16-25(29(37)38-30(2,3)4)33-27(35)24-17-18-26(23-14-9-6-10-15-23)34(28(24)36)20-22-12-7-5-8-13-22/h5-10,12-15,17-18,25H,11,16,19-20H2,1-4H3,(H2,31,32)(H,33,35)/t25-/m0/s1 |
| InChIKey | FEQOVHYILSGUJQ-VWLOTQADSA-N |
| XLogP | 4.16 |
| TPSA | 115.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|