C26H43N5O5 — CID 89492026
benzyl N-[3-[[(2S)-5-(1-aminoethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-2,2-dimethylpropyl]-N-methylcarbamate (PubChem CID 89492026) has the molecular formula C26H43N5O5 and a molecular weight of 505.66 g/mol. Its IUPAC name is benzyl N-[3-[[(2S)-5-(1-aminoethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-2,2-dimethylpropyl]-N-methylcarbamate.
| Compound Name | benzyl N-[3-[[(2S)-5-(1-aminoethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-2,2-dimethylpropyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 89492026 |
| Molecular Formula | C26H43N5O5 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.33 |
| IUPAC Name | benzyl N-[3-[[(2S)-5-(1-aminoethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]-2,2-dimethylpropyl]-N-methylcarbamate |
| SMILES | C/C(N)=N\CCC[C@H](NC(=O)OC(C)(C)C)C(=O)NCC(C)(C)CN(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H43N5O5/c1-19(27)28-15-11-14-21(30-23(33)36-25(2,3)4)22(32)29-17-26(5,6)18-31(7)24(34)35-16-20-12-9-8-10-13-20/h8-10,12-13,21H,11,14-18H2,1-7H3,(H2,27,28)(H,29,32)(H,30,33)/t21-/m0/s1 |
| InChIKey | WSPTZKYYJBQLTQ-NRFANRHFSA-N |
| XLogP | 3.45 |
| TPSA | 135.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|