C20H23BrN4O4 — CID 25156297
(2S)-5-(1-aminoethylideneamino)-2-[[1-[(4-bromophenyl)methyl]-2-oxopyridine-3-carbonyl]amino]pentanoic acid (PubChem CID 25156297) has the molecular formula C20H23BrN4O4 and a molecular weight of 463.33 g/mol. Its IUPAC name is (2S)-5-(1-aminoethylideneamino)-2-[[1-[(4-bromophenyl)methyl]-2-oxopyridine-3-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(1-aminoethylideneamino)-2-[[1-[(4-bromophenyl)methyl]-2-oxopyridine-3-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 25156297 |
| Molecular Formula | C20H23BrN4O4 |
| Molecular Weight | 463.33 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | (2S)-5-(1-aminoethylideneamino)-2-[[1-[(4-bromophenyl)methyl]-2-oxopyridine-3-carbonyl]amino]pentanoic acid |
| SMILES | C/C(N)=N\CCC[C@H](NC(=O)c1cccn(Cc2ccc(Br)cc2)c1=O)C(=O)O |
| InChI | InChI=1S/C20H23BrN4O4/c1-13(22)23-10-2-5-17(20(28)29)24-18(26)16-4-3-11-25(19(16)27)12-14-6-8-15(21)9-7-14/h3-4,6-9,11,17H,2,5,10,12H2,1H3,(H2,22,23)(H,24,26)(H,28,29)/t17-/m0/s1 |
| InChIKey | JNFVDTFUSVYOHQ-KRWDZBQOSA-N |
| XLogP | 2.00 |
| TPSA | 126.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|