C20H25N5O4 — CID 143710124
5-(diaminomethylideneamino)-2-[[1-[(3-methylphenyl)methyl]-2-oxopyridine-3-carbonyl]amino]pentanoic acid (PubChem CID 143710124) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[[1-[(3-methylphenyl)methyl]-2-oxopyridine-3-carbonyl]amino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[[1-[(3-methylphenyl)methyl]-2-oxopyridine-3-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 143710124 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[[1-[(3-methylphenyl)methyl]-2-oxopyridine-3-carbonyl]amino]pentanoic acid |
| SMILES | Cc1cccc(Cn2cccc(C(=O)NC(CCCN=C(N)N)C(=O)O)c2=O)c1 |
| InChI | InChI=1S/C20H25N5O4/c1-13-5-2-6-14(11-13)12-25-10-4-7-15(18(25)27)17(26)24-16(19(28)29)8-3-9-23-20(21)22/h2,4-7,10-11,16H,3,8-9,12H2,1H3,(H,24,26)(H,28,29)(H4,21,22,23) |
| InChIKey | UBJUODQBOHPNNF-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 152.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|