C18H28N4O4 — CID 143710062
5-(1-aminoethenylamino)-2-[[1-(2,2-dimethylpropyl)-2-oxopyridine-3-carbonyl]amino]pentanoic acid (PubChem CID 143710062) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is 5-(1-aminoethenylamino)-2-[[1-(2,2-dimethylpropyl)-2-oxopyridine-3-carbonyl]amino]pentanoic acid.
| Compound Name | 5-(1-aminoethenylamino)-2-[[1-(2,2-dimethylpropyl)-2-oxopyridine-3-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 143710062 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | 5-(1-aminoethenylamino)-2-[[1-(2,2-dimethylpropyl)-2-oxopyridine-3-carbonyl]amino]pentanoic acid |
| SMILES | C=C(N)NCCCC(NC(=O)c1cccn(CC(C)(C)C)c1=O)C(=O)O |
| InChI | InChI=1S/C18H28N4O4/c1-12(19)20-9-5-8-14(17(25)26)21-15(23)13-7-6-10-22(16(13)24)11-18(2,3)4/h6-7,10,14,20H,1,5,8-9,11,19H2,2-4H3,(H,21,23)(H,25,26) |
| InChIKey | NUXUJWDSMHIUOE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 126.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|