C12H15F3N2O3 — CID 114608686
2-[[1-(2,2,2-trifluoroethyl)pyrrole-2-carbonyl]amino]pentanoic acid (PubChem CID 114608686) has the molecular formula C12H15F3N2O3 and a molecular weight of 292.26 g/mol. Its IUPAC name is 2-[[1-(2,2,2-trifluoroethyl)pyrrole-2-carbonyl]amino]pentanoic acid.
| Compound Name | 2-[[1-(2,2,2-trifluoroethyl)pyrrole-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 114608686 |
| Molecular Formula | C12H15F3N2O3 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-[[1-(2,2,2-trifluoroethyl)pyrrole-2-carbonyl]amino]pentanoic acid |
| SMILES | CCCC(NC(=O)c1cccn1CC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C12H15F3N2O3/c1-2-4-8(11(19)20)16-10(18)9-5-3-6-17(9)7-12(13,14)15/h3,5-6,8H,2,4,7H2,1H3,(H,16,18)(H,19,20) |
| InChIKey | VFMPKPOUESVLBP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |