C11H14F2N2O3 — CID 104939949
(2R)-2-[[1-(2,2-difluoroethyl)pyrrole-2-carbonyl]amino]butanoic acid (PubChem CID 104939949) has the molecular formula C11H14F2N2O3 and a molecular weight of 260.24 g/mol. Its IUPAC name is (2R)-2-[[1-(2,2-difluoroethyl)pyrrole-2-carbonyl]amino]butanoic acid.
| Compound Name | (2R)-2-[[1-(2,2-difluoroethyl)pyrrole-2-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 104939949 |
| Molecular Formula | C11H14F2N2O3 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (2R)-2-[[1-(2,2-difluoroethyl)pyrrole-2-carbonyl]amino]butanoic acid |
| SMILES | CC[C@@H](NC(=O)c1cccn1CC(F)F)C(=O)O |
| InChI | InChI=1S/C11H14F2N2O3/c1-2-7(11(17)18)14-10(16)8-4-3-5-15(8)6-9(12)13/h3-5,7,9H,2,6H2,1H3,(H,14,16)(H,17,18)/t7-/m1/s1 |
| InChIKey | TVUCIGSCFRAPMO-SSDOTTSWSA-N |
| XLogP | 1.35 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |