C34H37N5O2 — CID 54186438
(2S)-5-(diaminomethylideneamino)-N-(2,2-diphenylacetyl)-2-(2,2-diphenylethylamino)pentanamide (PubChem CID 54186438) has the molecular formula C34H37N5O2 and a molecular weight of 547.70 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-N-(2,2-diphenylacetyl)-2-(2,2-diphenylethylamino)pentanamide.
| Compound Name | (2S)-5-(diaminomethylideneamino)-N-(2,2-diphenylacetyl)-2-(2,2-diphenylethylamino)pentanamide |
|---|---|
| PubChem CID | 54186438 |
| Molecular Formula | C34H37N5O2 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-N-(2,2-diphenylacetyl)-2-(2,2-diphenylethylamino)pentanamide |
| SMILES | NC(N)=NCCC[C@H](NCC(c1ccccc1)c1ccccc1)C(=O)NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H37N5O2/c35-34(36)37-23-13-22-30(38-24-29(25-14-5-1-6-15-25)26-16-7-2-8-17-26)32(40)39-33(41)31(27-18-9-3-10-19-27)28-20-11-4-12-21-28/h1-12,14-21,29-31,38H,13,22-24H2,(H4,35,36,37)(H,39,40,41)/t30-/m0/s1 |
| InChIKey | PFKQXKMBWKOOJL-PMERELPUSA-N |
| XLogP | 4.31 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|