C29H36N6O4S — CID 67615186
(2S)-5-(diaminomethylideneamino)-N-(2,2-diphenylacetyl)-2-[[4-(methylsulfamoylmethyl)phenyl]methylamino]pentanamide (PubChem CID 67615186) has the molecular formula C29H36N6O4S and a molecular weight of 564.71 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-N-(2,2-diphenylacetyl)-2-[[4-(methylsulfamoylmethyl)phenyl]methylamino]pentanamide.
| Compound Name | (2S)-5-(diaminomethylideneamino)-N-(2,2-diphenylacetyl)-2-[[4-(methylsulfamoylmethyl)phenyl]methylamino]pentanamide |
|---|---|
| PubChem CID | 67615186 |
| Molecular Formula | C29H36N6O4S |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-N-(2,2-diphenylacetyl)-2-[[4-(methylsulfamoylmethyl)phenyl]methylamino]pentanamide |
| SMILES | CNS(=O)(=O)Cc1ccc(CN[C@@H](CCCN=C(N)N)C(=O)NC(=O)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H36N6O4S/c1-32-40(38,39)20-22-16-14-21(15-17-22)19-34-25(13-8-18-33-29(30)31)27(36)35-28(37)26(23-9-4-2-5-10-23)24-11-6-3-7-12-24/h2-7,9-12,14-17,25-26,32,34H,8,13,18-20H2,1H3,(H4,30,31,33)(H,35,36,37)/t25-/m0/s1 |
| InChIKey | YJGKTHFKEMMEBB-VWLOTQADSA-N |
| XLogP | 1.72 |
| TPSA | 168.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|