C30H37N7O3 — CID 67615104
(2R)-N-[[4-[(carbamoylamino)methyl]phenyl]methyl]-5-(diaminomethylideneamino)-2-[(2-oxo-3,3-diphenylpropyl)amino]pentanamide (PubChem CID 67615104) has the molecular formula C30H37N7O3 and a molecular weight of 543.67 g/mol. Its IUPAC name is (2R)-N-[[4-[(carbamoylamino)methyl]phenyl]methyl]-5-(diaminomethylideneamino)-2-[(2-oxo-3,3-diphenylpropyl)amino]pentanamide.
| Compound Name | (2R)-N-[[4-[(carbamoylamino)methyl]phenyl]methyl]-5-(diaminomethylideneamino)-2-[(2-oxo-3,3-diphenylpropyl)amino]pentanamide |
|---|---|
| PubChem CID | 67615104 |
| Molecular Formula | C30H37N7O3 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.30 |
| IUPAC Name | (2R)-N-[[4-[(carbamoylamino)methyl]phenyl]methyl]-5-(diaminomethylideneamino)-2-[(2-oxo-3,3-diphenylpropyl)amino]pentanamide |
| SMILES | NC(=O)NCc1ccc(CNC(=O)[C@@H](CCCN=C(N)N)NCC(=O)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H37N7O3/c31-29(32)34-17-7-12-25(28(39)36-18-21-13-15-22(16-14-21)19-37-30(33)40)35-20-26(38)27(23-8-3-1-4-9-23)24-10-5-2-6-11-24/h1-6,8-11,13-16,25,27,35H,7,12,17-20H2,(H,36,39)(H4,31,32,34)(H3,33,37,40)/t25-/m1/s1 |
| InChIKey | HJWMIZJYYWSJBX-RUZDIDTESA-N |
| XLogP | 1.88 |
| TPSA | 177.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|