C35H47N7O5 — CID 161297647
acetic acid;(2R)-5-(diaminomethylideneamino)-N-[[4-[2-[2-(dimethylamino)ethylamino]-2-oxoethyl]phenyl]methyl]-2-[(2,2-diphenylacetyl)amino]pentanamide (PubChem CID 161297647) has the molecular formula C35H47N7O5 and a molecular weight of 645.80 g/mol. Its IUPAC name is acetic acid;(2R)-5-(diaminomethylideneamino)-N-[[4-[2-[2-(dimethylamino)ethylamino]-2-oxoethyl]phenyl]methyl]-2-[(2,2-diphenylacetyl)amino]pentanamide.
| Compound Name | acetic acid;(2R)-5-(diaminomethylideneamino)-N-[[4-[2-[2-(dimethylamino)ethylamino]-2-oxoethyl]phenyl]methyl]-2-[(2,2-diphenylacetyl)amino]pentanamide |
|---|---|
| PubChem CID | 161297647 |
| Molecular Formula | C35H47N7O5 |
| Molecular Weight | 645.80 g/mol |
| Exact Mass | 645.36 |
| IUPAC Name | acetic acid;(2R)-5-(diaminomethylideneamino)-N-[[4-[2-[2-(dimethylamino)ethylamino]-2-oxoethyl]phenyl]methyl]-2-[(2,2-diphenylacetyl)amino]pentanamide |
| SMILES | CC(=O)O.CN(C)CCNC(=O)Cc1ccc(CNC(=O)[C@@H](CCCN=C(N)N)NC(=O)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H43N7O3.C2H4O2/c1-40(2)21-20-36-29(41)22-24-15-17-25(18-16-24)23-38-31(42)28(14-9-19-37-33(34)35)39-32(43)30(26-10-5-3-6-11-26)27-12-7-4-8-13-27;1-2(3)4/h3-8,10-13,15-18,28,30H,9,14,19-23H2,1-2H3,(H,36,41)(H,38,42)(H,39,43)(H4,34,35,37);1H3,(H,3,4)/t28-;/m1./s1 |
| InChIKey | VHEMONKPNAVJAK-LNLSOMNWSA-N |
| XLogP | 1.98 |
| TPSA | 192.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.80 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|