C29H35N5O2 — CID 70280595
(2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)amino]-N-methyl-N-(2-phenylethyl)pentanamide (PubChem CID 70280595) has the molecular formula C29H35N5O2 and a molecular weight of 485.63 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)amino]-N-methyl-N-(2-phenylethyl)pentanamide.
| Compound Name | (2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)amino]-N-methyl-N-(2-phenylethyl)pentanamide |
|---|---|
| PubChem CID | 70280595 |
| Molecular Formula | C29H35N5O2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)amino]-N-methyl-N-(2-phenylethyl)pentanamide |
| SMILES | CN(CCc1ccccc1)C(=O)[C@@H](CCCN=C(N)N)NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H35N5O2/c1-34(21-19-22-12-5-2-6-13-22)28(36)25(18-11-20-32-29(30)31)33-27(35)26(23-14-7-3-8-15-23)24-16-9-4-10-17-24/h2-10,12-17,25-26H,11,18-21H2,1H3,(H,33,35)(H4,30,31,32)/t25-/m1/s1 |
| InChIKey | LPGYLXRDTXDHMT-RUZDIDTESA-N |
| XLogP | 3.06 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|