C27H29Cl2N5O3 — CID 175613933
(2R)-5-(diaminomethylideneamino)-N-[(2,6-dichloro-4-hydroxyphenyl)methyl]-2-[(2,2-diphenylacetyl)amino]pentanamide (PubChem CID 175613933) has the molecular formula C27H29Cl2N5O3 and a molecular weight of 542.47 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-N-[(2,6-dichloro-4-hydroxyphenyl)methyl]-2-[(2,2-diphenylacetyl)amino]pentanamide.
| Compound Name | (2R)-5-(diaminomethylideneamino)-N-[(2,6-dichloro-4-hydroxyphenyl)methyl]-2-[(2,2-diphenylacetyl)amino]pentanamide |
|---|---|
| PubChem CID | 175613933 |
| Molecular Formula | C27H29Cl2N5O3 |
| Molecular Weight | 542.47 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-N-[(2,6-dichloro-4-hydroxyphenyl)methyl]-2-[(2,2-diphenylacetyl)amino]pentanamide |
| SMILES | NC(N)=NCCC[C@@H](NC(=O)C(c1ccccc1)c1ccccc1)C(=O)NCc1c(Cl)cc(O)cc1Cl |
| InChI | InChI=1S/C27H29Cl2N5O3/c28-21-14-19(35)15-22(29)20(21)16-33-25(36)23(12-7-13-32-27(30)31)34-26(37)24(17-8-3-1-4-9-17)18-10-5-2-6-11-18/h1-6,8-11,14-15,23-24,35H,7,12-13,16H2,(H,33,36)(H,34,37)(H4,30,31,32)/t23-/m1/s1 |
| InChIKey | VFGWPIFMZZBSCX-HSZRJFAPSA-N |
| XLogP | 3.69 |
| TPSA | 142.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|