C16H20N4O2 — CID 174579623
5-(diaminomethylideneamino)-2-(naphthalen-2-ylamino)pentanoic acid (PubChem CID 174579623) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-(naphthalen-2-ylamino)pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-(naphthalen-2-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 174579623 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-(naphthalen-2-ylamino)pentanoic acid |
| SMILES | NC(N)=NCCCC(Nc1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C16H20N4O2/c17-16(18)19-9-3-6-14(15(21)22)20-13-8-7-11-4-1-2-5-12(11)10-13/h1-2,4-5,7-8,10,14,20H,3,6,9H2,(H,21,22)(H4,17,18,19) |
| InChIKey | WNRRVHYVMUCEHZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|