C27H29N5O — CID 101159513
(2R)-5-(diaminomethylideneamino)-N-naphthalen-1-yl-2-(naphthalen-2-ylmethylamino)pentanamide (PubChem CID 101159513) has the molecular formula C27H29N5O and a molecular weight of 439.56 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-N-naphthalen-1-yl-2-(naphthalen-2-ylmethylamino)pentanamide.
| Compound Name | (2R)-5-(diaminomethylideneamino)-N-naphthalen-1-yl-2-(naphthalen-2-ylmethylamino)pentanamide |
|---|---|
| PubChem CID | 101159513 |
| Molecular Formula | C27H29N5O |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-N-naphthalen-1-yl-2-(naphthalen-2-ylmethylamino)pentanamide |
| SMILES | NC(N)=NCCC[C@@H](NCc1ccc2ccccc2c1)C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C27H29N5O/c28-27(29)30-16-6-13-25(31-18-19-14-15-20-7-1-2-9-22(20)17-19)26(33)32-24-12-5-10-21-8-3-4-11-23(21)24/h1-5,7-12,14-15,17,25,31H,6,13,16,18H2,(H,32,33)(H4,28,29,30)/t25-/m1/s1 |
| InChIKey | MOENHRSRNGVQFI-RUZDIDTESA-N |
| XLogP | 4.14 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|