C31H37N9O6 — CID 139413769
(2S)-5-(diaminomethylideneamino)-2-[[(2S)-5-(diaminomethylideneamino)-2-[[2-[2-(naphthalene-2-carbonylamino)phenyl]-2-oxoacetyl]amino]pentanoyl]amino]pentanoic acid (PubChem CID 139413769) has the molecular formula C31H37N9O6 and a molecular weight of 631.69 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[(2S)-5-(diaminomethylideneamino)-2-[[2-[2-(naphthalene-2-carbonylamino)phenyl]-2-oxoacetyl]amino]pentanoyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[(2S)-5-(diaminomethylideneamino)-2-[[2-[2-(naphthalene-2-carbonylamino)phenyl]-2-oxoacetyl]amino]pentanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 139413769 |
| Molecular Formula | C31H37N9O6 |
| Molecular Weight | 631.69 g/mol |
| Exact Mass | 631.29 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[(2S)-5-(diaminomethylideneamino)-2-[[2-[2-(naphthalene-2-carbonylamino)phenyl]-2-oxoacetyl]amino]pentanoyl]amino]pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)C(=O)c1ccccc1NC(=O)c1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C31H37N9O6/c32-30(33)36-15-5-11-23(27(43)40-24(29(45)46)12-6-16-37-31(34)35)39-28(44)25(41)21-9-3-4-10-22(21)38-26(42)20-14-13-18-7-1-2-8-19(18)17-20/h1-4,7-10,13-14,17,23-24H,5-6,11-12,15-16H2,(H,38,42)(H,39,44)(H,40,43)(H,45,46)(H4,32,33,36)(H4,34,35,37)/t23-,24-/m0/s1 |
| InChIKey | ABKQQOGKWGKGIZ-ZEQRLZLVSA-N |
| XLogP | 0.44 |
| TPSA | 270.47 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.69 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|