C26H28ClN3O5 — CID 142340159
methyl (2S)-6-amino-2-[[2-[2-(naphthalene-2-carbonylamino)phenyl]-2-oxoacetyl]amino]hexanoate;hydrochloride (PubChem CID 142340159) has the molecular formula C26H28ClN3O5 and a molecular weight of 497.98 g/mol. Its IUPAC name is methyl (2S)-6-amino-2-[[2-[2-(naphthalene-2-carbonylamino)phenyl]-2-oxoacetyl]amino]hexanoate;hydrochloride.
| Compound Name | methyl (2S)-6-amino-2-[[2-[2-(naphthalene-2-carbonylamino)phenyl]-2-oxoacetyl]amino]hexanoate;hydrochloride |
|---|---|
| PubChem CID | 142340159 |
| Molecular Formula | C26H28ClN3O5 |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | methyl (2S)-6-amino-2-[[2-[2-(naphthalene-2-carbonylamino)phenyl]-2-oxoacetyl]amino]hexanoate;hydrochloride |
| SMILES | COC(=O)[C@H](CCCCN)NC(=O)C(=O)c1ccccc1NC(=O)c1ccc2ccccc2c1.Cl |
| InChI | InChI=1S/C26H27N3O5.ClH/c1-34-26(33)22(12-6-7-15-27)29-25(32)23(30)20-10-4-5-11-21(20)28-24(31)19-14-13-17-8-2-3-9-18(17)16-19;/h2-5,8-11,13-14,16,22H,6-7,12,15,27H2,1H3,(H,28,31)(H,29,32);1H/t22-;/m0./s1 |
| InChIKey | NVLZCBNXGPYABK-FTBISJDPSA-N |
| XLogP | 3.48 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|