C22H21Cl2N3O3 — CID 139413786
N-[2-[2-(3-aminopropylamino)-2-oxoacetyl]-4-chlorophenyl]naphthalene-2-carboxamide;hydrochloride (PubChem CID 139413786) has the molecular formula C22H21Cl2N3O3 and a molecular weight of 446.33 g/mol. Its IUPAC name is N-[2-[2-(3-aminopropylamino)-2-oxoacetyl]-4-chlorophenyl]naphthalene-2-carboxamide;hydrochloride.
| Compound Name | N-[2-[2-(3-aminopropylamino)-2-oxoacetyl]-4-chlorophenyl]naphthalene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 139413786 |
| Molecular Formula | C22H21Cl2N3O3 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | N-[2-[2-(3-aminopropylamino)-2-oxoacetyl]-4-chlorophenyl]naphthalene-2-carboxamide;hydrochloride |
| SMILES | Cl.NCCCNC(=O)C(=O)c1cc(Cl)ccc1NC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H20ClN3O3.ClH/c23-17-8-9-19(18(13-17)20(27)22(29)25-11-3-10-24)26-21(28)16-7-6-14-4-1-2-5-15(14)12-16;/h1-2,4-9,12-13H,3,10-11,24H2,(H,25,29)(H,26,28);1H |
| InChIKey | AGHRTTDCYXCRHS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|