C23H23BrClN5O3 — CID 139413728
N-[4-bromo-2-[2-[1-(diaminomethylideneamino)propylamino]-2-oxoacetyl]phenyl]naphthalene-2-carboxamide;hydrochloride (PubChem CID 139413728) has the molecular formula C23H23BrClN5O3 and a molecular weight of 532.83 g/mol. Its IUPAC name is N-[4-bromo-2-[2-[1-(diaminomethylideneamino)propylamino]-2-oxoacetyl]phenyl]naphthalene-2-carboxamide;hydrochloride.
| Compound Name | N-[4-bromo-2-[2-[1-(diaminomethylideneamino)propylamino]-2-oxoacetyl]phenyl]naphthalene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 139413728 |
| Molecular Formula | C23H23BrClN5O3 |
| Molecular Weight | 532.83 g/mol |
| Exact Mass | 531.07 |
| IUPAC Name | N-[4-bromo-2-[2-[1-(diaminomethylideneamino)propylamino]-2-oxoacetyl]phenyl]naphthalene-2-carboxamide;hydrochloride |
| SMILES | CCC(N=C(N)N)NC(=O)C(=O)c1cc(Br)ccc1NC(=O)c1ccc2ccccc2c1.Cl |
| InChI | InChI=1S/C23H22BrN5O3.ClH/c1-2-19(29-23(25)26)28-22(32)20(30)17-12-16(24)9-10-18(17)27-21(31)15-8-7-13-5-3-4-6-14(13)11-15;/h3-12,19H,2H2,1H3,(H,27,31)(H,28,32)(H4,25,26,29);1H |
| InChIKey | VWRUTLSBSKNWAL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.83 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|