C26H26FN5O5 — CID 153425182
(2S)-6-(diaminomethylideneamino)-2-[[2-[5-fluoro-2-(naphthalene-2-carbonylamino)phenyl]-2-oxoacetyl]amino]hexanoic acid (PubChem CID 153425182) has the molecular formula C26H26FN5O5 and a molecular weight of 507.52 g/mol. Its IUPAC name is (2S)-6-(diaminomethylideneamino)-2-[[2-[5-fluoro-2-(naphthalene-2-carbonylamino)phenyl]-2-oxoacetyl]amino]hexanoic acid.
| Compound Name | (2S)-6-(diaminomethylideneamino)-2-[[2-[5-fluoro-2-(naphthalene-2-carbonylamino)phenyl]-2-oxoacetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 153425182 |
| Molecular Formula | C26H26FN5O5 |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | (2S)-6-(diaminomethylideneamino)-2-[[2-[5-fluoro-2-(naphthalene-2-carbonylamino)phenyl]-2-oxoacetyl]amino]hexanoic acid |
| SMILES | NC(N)=NCCCC[C@H](NC(=O)C(=O)c1cc(F)ccc1NC(=O)c1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C26H26FN5O5/c27-18-10-11-20(31-23(34)17-9-8-15-5-1-2-6-16(15)13-17)19(14-18)22(33)24(35)32-21(25(36)37)7-3-4-12-30-26(28)29/h1-2,5-6,8-11,13-14,21H,3-4,7,12H2,(H,31,34)(H,32,35)(H,36,37)(H4,28,29,30)/t21-/m0/s1 |
| InChIKey | LTOWCAZFDZWJLA-NRFANRHFSA-N |
| XLogP | 2.43 |
| TPSA | 176.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|