C23H23N5O3 — CID 139413723
N-[2-[2-[1-(diaminomethylideneamino)propylamino]-2-oxoacetyl]phenyl]naphthalene-2-carboxamide (PubChem CID 139413723) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is N-[2-[2-[1-(diaminomethylideneamino)propylamino]-2-oxoacetyl]phenyl]naphthalene-2-carboxamide.
| Compound Name | N-[2-[2-[1-(diaminomethylideneamino)propylamino]-2-oxoacetyl]phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 139413723 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | N-[2-[2-[1-(diaminomethylideneamino)propylamino]-2-oxoacetyl]phenyl]naphthalene-2-carboxamide |
| SMILES | CCC(N=C(N)N)NC(=O)C(=O)c1ccccc1NC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H23N5O3/c1-2-19(28-23(24)25)27-22(31)20(29)17-9-5-6-10-18(17)26-21(30)16-12-11-14-7-3-4-8-15(14)13-16/h3-13,19H,2H2,1H3,(H,26,30)(H,27,31)(H4,24,25,28) |
| InChIKey | VZAFJMMCVBKSEV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|