C27H29N5O5 — CID 153425178
(2S)-6-(diaminomethylideneamino)-2-[[2-[5-methyl-2-(naphthalene-2-carbonylamino)phenyl]-2-oxoacetyl]amino]hexanoic acid (PubChem CID 153425178) has the molecular formula C27H29N5O5 and a molecular weight of 503.56 g/mol. Its IUPAC name is (2S)-6-(diaminomethylideneamino)-2-[[2-[5-methyl-2-(naphthalene-2-carbonylamino)phenyl]-2-oxoacetyl]amino]hexanoic acid.
| Compound Name | (2S)-6-(diaminomethylideneamino)-2-[[2-[5-methyl-2-(naphthalene-2-carbonylamino)phenyl]-2-oxoacetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 153425178 |
| Molecular Formula | C27H29N5O5 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | (2S)-6-(diaminomethylideneamino)-2-[[2-[5-methyl-2-(naphthalene-2-carbonylamino)phenyl]-2-oxoacetyl]amino]hexanoic acid |
| SMILES | Cc1ccc(NC(=O)c2ccc3ccccc3c2)c(C(=O)C(=O)N[C@@H](CCCCN=C(N)N)C(=O)O)c1 |
| InChI | InChI=1S/C27H29N5O5/c1-16-9-12-21(31-24(34)19-11-10-17-6-2-3-7-18(17)15-19)20(14-16)23(33)25(35)32-22(26(36)37)8-4-5-13-30-27(28)29/h2-3,6-7,9-12,14-15,22H,4-5,8,13H2,1H3,(H,31,34)(H,32,35)(H,36,37)(H4,28,29,30)/t22-/m0/s1 |
| InChIKey | AAKZCPQQUKMGTR-QFIPXVFZSA-N |
| XLogP | 2.60 |
| TPSA | 176.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|