C17H19NO4 — CID 101108438
methyl (2S)-4-methoxy-2-(naphthalene-2-carbonylamino)butanoate (PubChem CID 101108438) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is methyl (2S)-4-methoxy-2-(naphthalene-2-carbonylamino)butanoate.
| Compound Name | methyl (2S)-4-methoxy-2-(naphthalene-2-carbonylamino)butanoate |
|---|---|
| PubChem CID | 101108438 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | methyl (2S)-4-methoxy-2-(naphthalene-2-carbonylamino)butanoate |
| SMILES | COCC[C@H](NC(=O)c1ccc2ccccc2c1)C(=O)OC |
| InChI | InChI=1S/C17H19NO4/c1-21-10-9-15(17(20)22-2)18-16(19)14-8-7-12-5-3-4-6-13(12)11-14/h3-8,11,15H,9-10H2,1-2H3,(H,18,19)/t15-/m0/s1 |
| InChIKey | MFCRBVCSKFBTBY-HNNXBMFYSA-N |
| XLogP | 2.15 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |