C20H25N3O4 — CID 45157636
naphthalen-2-yl 2-[(2-acetamidoacetyl)amino]-6-aminohexanoate (PubChem CID 45157636) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is naphthalen-2-yl 2-[(2-acetamidoacetyl)amino]-6-aminohexanoate.
| Compound Name | naphthalen-2-yl 2-[(2-acetamidoacetyl)amino]-6-aminohexanoate |
|---|---|
| PubChem CID | 45157636 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | naphthalen-2-yl 2-[(2-acetamidoacetyl)amino]-6-aminohexanoate |
| SMILES | CC(=O)NCC(=O)NC(CCCCN)C(=O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H25N3O4/c1-14(24)22-13-19(25)23-18(8-4-5-11-21)20(26)27-17-10-9-15-6-2-3-7-16(15)12-17/h2-3,6-7,9-10,12,18H,4-5,8,11,13,21H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | MKLPFOVLYHHKFD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|