C23H33N3O4 — CID 166479079
[3,4-bis(ethenyl)phenyl] 6-amino-2-[[2-(pentanoylamino)acetyl]amino]hexanoate (PubChem CID 166479079) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is [3,4-bis(ethenyl)phenyl] 6-amino-2-[[2-(pentanoylamino)acetyl]amino]hexanoate.
| Compound Name | [3,4-bis(ethenyl)phenyl] 6-amino-2-[[2-(pentanoylamino)acetyl]amino]hexanoate |
|---|---|
| PubChem CID | 166479079 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | [3,4-bis(ethenyl)phenyl] 6-amino-2-[[2-(pentanoylamino)acetyl]amino]hexanoate |
| SMILES | C=Cc1ccc(OC(=O)C(CCCCN)NC(=O)CNC(=O)CCCC)cc1C=C |
| InChI | InChI=1S/C23H33N3O4/c1-4-7-11-21(27)25-16-22(28)26-20(10-8-9-14-24)23(29)30-19-13-12-17(5-2)18(6-3)15-19/h5-6,12-13,15,20H,2-4,7-11,14,16,24H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | WARSPCKSWOAPLS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|