C22H43N3O8 — CID 87756856
(2S)-6-amino-2-[3-[2-[2-[2-[2-(pentanoylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]hexanoic acid (PubChem CID 87756856) has the molecular formula C22H43N3O8 and a molecular weight of 477.60 g/mol. Its IUPAC name is (2S)-6-amino-2-[3-[2-[2-[2-[2-(pentanoylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[3-[2-[2-[2-[2-(pentanoylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 87756856 |
| Molecular Formula | C22H43N3O8 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | (2S)-6-amino-2-[3-[2-[2-[2-[2-(pentanoylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]hexanoic acid |
| SMILES | CCCCC(=O)NCCOCCOCCOCCOCCC(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C22H43N3O8/c1-2-3-7-20(26)24-10-12-31-14-16-33-18-17-32-15-13-30-11-8-21(27)25-19(22(28)29)6-4-5-9-23/h19H,2-18,23H2,1H3,(H,24,26)(H,25,27)(H,28,29)/t19-/m0/s1 |
| InChIKey | QFHBQCWDHQQWOX-IBGZPJMESA-N |
| XLogP | 0.45 |
| TPSA | 158.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|