C20H38N2O6 — CID 170413527
5-[2-(2-ethoxyethoxy)ethylamino]-2-(nonanoylamino)-5-oxopentanoic acid (PubChem CID 170413527) has the molecular formula C20H38N2O6 and a molecular weight of 402.53 g/mol. Its IUPAC name is 5-[2-(2-ethoxyethoxy)ethylamino]-2-(nonanoylamino)-5-oxopentanoic acid.
| Compound Name | 5-[2-(2-ethoxyethoxy)ethylamino]-2-(nonanoylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 170413527 |
| Molecular Formula | C20H38N2O6 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | 5-[2-(2-ethoxyethoxy)ethylamino]-2-(nonanoylamino)-5-oxopentanoic acid |
| SMILES | CCCCCCCCC(=O)NC(CCC(=O)NCCOCCOCC)C(=O)O |
| InChI | InChI=1S/C20H38N2O6/c1-3-5-6-7-8-9-10-19(24)22-17(20(25)26)11-12-18(23)21-13-14-28-16-15-27-4-2/h17H,3-16H2,1-2H3,(H,21,23)(H,22,24)(H,25,26) |
| InChIKey | SNCAIRWCZVRDPC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|