C18H33N3O7 — CID 143771949
5-[2-[2-[2-(butylamino)-2-oxoethoxy]ethoxy]ethylamino]-5-oxo-2-(propanoylamino)pentanoic acid (PubChem CID 143771949) has the molecular formula C18H33N3O7 and a molecular weight of 403.48 g/mol. Its IUPAC name is 5-[2-[2-[2-(butylamino)-2-oxoethoxy]ethoxy]ethylamino]-5-oxo-2-(propanoylamino)pentanoic acid.
| Compound Name | 5-[2-[2-[2-(butylamino)-2-oxoethoxy]ethoxy]ethylamino]-5-oxo-2-(propanoylamino)pentanoic acid |
|---|---|
| PubChem CID | 143771949 |
| Molecular Formula | C18H33N3O7 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 5-[2-[2-[2-(butylamino)-2-oxoethoxy]ethoxy]ethylamino]-5-oxo-2-(propanoylamino)pentanoic acid |
| SMILES | CCCCNC(=O)COCCOCCNC(=O)CCC(NC(=O)CC)C(=O)O |
| InChI | InChI=1S/C18H33N3O7/c1-3-5-8-19-17(24)13-28-12-11-27-10-9-20-16(23)7-6-14(18(25)26)21-15(22)4-2/h14H,3-13H2,1-2H3,(H,19,24)(H,20,23)(H,21,22)(H,25,26) |
| InChIKey | QQRZVVVNZKHYOZ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|