C18H30N4O5 — CID 166678358
ethyl 6-amino-2-[[2-[[2-(hex-5-ynoylamino)acetyl]amino]acetyl]amino]hexanoate (PubChem CID 166678358) has the molecular formula C18H30N4O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is ethyl 6-amino-2-[[2-[[2-(hex-5-ynoylamino)acetyl]amino]acetyl]amino]hexanoate.
| Compound Name | ethyl 6-amino-2-[[2-[[2-(hex-5-ynoylamino)acetyl]amino]acetyl]amino]hexanoate |
|---|---|
| PubChem CID | 166678358 |
| Molecular Formula | C18H30N4O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | ethyl 6-amino-2-[[2-[[2-(hex-5-ynoylamino)acetyl]amino]acetyl]amino]hexanoate |
| SMILES | C#CCCCC(=O)NCC(=O)NCC(=O)NC(CCCCN)C(=O)OCC |
| InChI | InChI=1S/C18H30N4O5/c1-3-5-6-10-15(23)20-12-16(24)21-13-17(25)22-14(9-7-8-11-19)18(26)27-4-2/h1,14H,4-13,19H2,2H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | GRXFARJEKGDHTP-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|