C20H17NO3 — CID 43030693
naphthalen-2-yl 4-(acetamidomethyl)benzoate (PubChem CID 43030693) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is naphthalen-2-yl 4-(acetamidomethyl)benzoate.
| Compound Name | naphthalen-2-yl 4-(acetamidomethyl)benzoate |
|---|---|
| PubChem CID | 43030693 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | naphthalen-2-yl 4-(acetamidomethyl)benzoate |
| SMILES | CC(=O)NCc1ccc(C(=O)Oc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C20H17NO3/c1-14(22)21-13-15-6-8-17(9-7-15)20(23)24-19-11-10-16-4-2-3-5-18(16)12-19/h2-12H,13H2,1H3,(H,21,22) |
| InChIKey | XLJDBKGZANLJBB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|