C16H12Cl3NO3 — CID 46819914
(2,4,6-trichlorophenyl) 4-(acetamidomethyl)benzoate (PubChem CID 46819914) has the molecular formula C16H12Cl3NO3 and a molecular weight of 372.64 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) 4-(acetamidomethyl)benzoate.
| Compound Name | (2,4,6-trichlorophenyl) 4-(acetamidomethyl)benzoate |
|---|---|
| PubChem CID | 46819914 |
| Molecular Formula | C16H12Cl3NO3 |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | (2,4,6-trichlorophenyl) 4-(acetamidomethyl)benzoate |
| SMILES | CC(=O)NCc1ccc(C(=O)Oc2c(Cl)cc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H12Cl3NO3/c1-9(21)20-8-10-2-4-11(5-3-10)16(22)23-15-13(18)6-12(17)7-14(15)19/h2-7H,8H2,1H3,(H,20,21) |
| InChIKey | KLXWBHAAEUVUSH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|